Silaimines, complexes

Facile Synthesis of Silaimine Complex PhC(NlBu)2Si(CI)=N(2.6-fPr2CEH3) 209... 

Major advances in organometallic chemistry during the last years have been achieved in the area of silicon-metal multiple bonding and silicon with low coordination numbers. For late transition metals, new complexes have been synthesized such as silanediyl (A), silene (B), silaimine (C), disilene (D), silatrimethylenemethane (E), silacarbynes (F), cyclic silylenes (G), silacyclopentadiene (H) and metalla-sila-allenes (I) (Figure 3). 

Silylene-azide complexes are probable intermediates in the formation of silaimines from silylenes and covalent azides (equation 66)147,148. 

---